C26H29NO2 — CID 70666605
[(1R,9R,13S)-4-hydroxy-1-methyl-10-azatetracyclo[7.3.1.02,7.011,13]trideca-2(7),3,5-trien-10-yl]-(1-phenylcyclohexyl)methanone (PubChem CID 70666605) has the molecular formula C26H29NO2 and a molecular weight of 387.52 g/mol. Its IUPAC name is [(1R,9R,13S)-4-hydroxy-1-methyl-10-azatetracyclo[7.3.1.02,7.011,13]trideca-2(7),3,5-trien-10-yl]-(1-phenylcyclohexyl)methanone.
| Compound Name | [(1R,9R,13S)-4-hydroxy-1-methyl-10-azatetracyclo[7.3.1.02,7.011,13]trideca-2(7),3,5-trien-10-yl]-(1-phenylcyclohexyl)methanone |
|---|---|
| PubChem CID | 70666605 |
| Molecular Formula | C26H29NO2 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.22 |
| IUPAC Name | [(1R,9R,13S)-4-hydroxy-1-methyl-10-azatetracyclo[7.3.1.02,7.011,13]trideca-2(7),3,5-trien-10-yl]-(1-phenylcyclohexyl)methanone |
| SMILES | C[C@@]12CC3[C@H]1[C@@H](Cc1ccc(O)cc12)N3C(=O)C1(c2ccccc2)CCCCC1 |
| InChI | InChI=1S/C26H29NO2/c1-25-16-22-23(25)21(14-17-10-11-19(28)15-20(17)25)27(22)24(29)26(12-6-3-7-13-26)18-8-4-2-5-9-18/h2,4-5,8-11,15,21-23,28H,3,6-7,12-14,16H2,1H3/t21-,22?,23-,25+/m1/s1 |
| InChIKey | NONFINCOBUZFRJ-IQSHEIPESA-N |
| XLogP | 4.71 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |