C31H36N2O3 — CID 90123095
4-[(1R,13S)-4,13-dihydroxy-1-methyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]-N,N-dimethyl-2,2-diphenylbutanamide (PubChem CID 90123095) has the molecular formula C31H36N2O3 and a molecular weight of 484.64 g/mol. Its IUPAC name is 4-[(1R,13S)-4,13-dihydroxy-1-methyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]-N,N-dimethyl-2,2-diphenylbutanamide.
| Compound Name | 4-[(1R,13S)-4,13-dihydroxy-1-methyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]-N,N-dimethyl-2,2-diphenylbutanamide |
|---|---|
| PubChem CID | 90123095 |
| Molecular Formula | C31H36N2O3 |
| Molecular Weight | 484.64 g/mol |
| Exact Mass | 484.27 |
| IUPAC Name | 4-[(1R,13S)-4,13-dihydroxy-1-methyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]-N,N-dimethyl-2,2-diphenylbutanamide |
| SMILES | CN(C)C(=O)C(CCN1CC[C@]2(C)c3cc(O)ccc3CC1[C@H]2O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H36N2O3/c1-30-16-18-33(27(28(30)35)20-22-14-15-25(34)21-26(22)30)19-17-31(29(36)32(2)3,23-10-6-4-7-11-23)24-12-8-5-9-13-24/h4-15,21,27-28,34-35H,16-20H2,1-3H3/t27?,28-,30-/m1/s1 |
| InChIKey | RGAWFZIWSXDSHP-DNBLXOHRSA-N |
| XLogP | 4.11 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.64 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |