C40H45N5O3 — CID 123144976
4-[4-hydroxy-13-[(4-methanimidoylphenyl)carbamoyl-methylamino]-1-methyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]-N,N-dimethyl-2,2-diphenylbutanamide (PubChem CID 123144976) has the molecular formula C40H45N5O3 and a molecular weight of 643.83 g/mol. Its IUPAC name is 4-[4-hydroxy-13-[(4-methanimidoylphenyl)carbamoyl-methylamino]-1-methyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]-N,N-dimethyl-2,2-diphenylbutanamide.
| Compound Name | 4-[4-hydroxy-13-[(4-methanimidoylphenyl)carbamoyl-methylamino]-1-methyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]-N,N-dimethyl-2,2-diphenylbutanamide |
|---|---|
| PubChem CID | 123144976 |
| Molecular Formula | C40H45N5O3 |
| Molecular Weight | 643.83 g/mol |
| Exact Mass | 643.35 |
| IUPAC Name | 4-[4-hydroxy-13-[(4-methanimidoylphenyl)carbamoyl-methylamino]-1-methyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-10-yl]-N,N-dimethyl-2,2-diphenylbutanamide |
| SMILES | [H]/N=C/c1ccc(NC(=O)N(C)C2C3Cc4ccc(O)cc4C2(C)CCN3CCC(C(=O)N(C)C)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C40H45N5O3/c1-39-21-23-45(24-22-40(37(47)43(2)3,30-11-7-5-8-12-30)31-13-9-6-10-14-31)35(25-29-17-20-33(46)26-34(29)39)36(39)44(4)38(48)42-32-18-15-28(27-41)16-19-32/h5-20,26-27,35-36,41,46H,21-25H2,1-4H3,(H,42,48)/b41-27+ |
| InChIKey | VFIMVPXIUKCUAX-GLNSOGGISA-N |
| XLogP | 6.28 |
| TPSA | 99.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.83 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|