C23H26N4O3 — CID 140778656
3-(1,3-benzoxazol-2-yl)-1-[(9R,13R)-4-hydroxy-1,10-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-13-yl]-1-methylurea (PubChem CID 140778656) has the molecular formula C23H26N4O3 and a molecular weight of 406.49 g/mol. Its IUPAC name is 3-(1,3-benzoxazol-2-yl)-1-[(9R,13R)-4-hydroxy-1,10-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-13-yl]-1-methylurea.
| Compound Name | 3-(1,3-benzoxazol-2-yl)-1-[(9R,13R)-4-hydroxy-1,10-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-13-yl]-1-methylurea |
|---|---|
| PubChem CID | 140778656 |
| Molecular Formula | C23H26N4O3 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | 3-(1,3-benzoxazol-2-yl)-1-[(9R,13R)-4-hydroxy-1,10-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-13-yl]-1-methylurea |
| SMILES | CN1CCC2(C)c3cc(O)ccc3C[C@@H]1[C@@H]2N(C)C(=O)Nc1nc2ccccc2o1 |
| InChI | InChI=1S/C23H26N4O3/c1-23-10-11-26(2)18(12-14-8-9-15(28)13-16(14)23)20(23)27(3)22(29)25-21-24-17-6-4-5-7-19(17)30-21/h4-9,13,18,20,28H,10-12H2,1-3H3,(H,24,25,29)/t18-,20+,23?/m1/s1 |
| InChIKey | GVFCYEQNWYUSIE-KPNPHKMBSA-N |
| XLogP | 3.58 |
| TPSA | 81.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |