C22H23FN4O2S — CID 140778607
1-(5-fluoro-1,3-benzothiazol-2-yl)-3-[(9R,13S)-4-hydroxy-1,10-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-13-yl]urea (PubChem CID 140778607) has the molecular formula C22H23FN4O2S and a molecular weight of 426.52 g/mol. Its IUPAC name is 1-(5-fluoro-1,3-benzothiazol-2-yl)-3-[(9R,13S)-4-hydroxy-1,10-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-13-yl]urea.
| Compound Name | 1-(5-fluoro-1,3-benzothiazol-2-yl)-3-[(9R,13S)-4-hydroxy-1,10-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-13-yl]urea |
|---|---|
| PubChem CID | 140778607 |
| Molecular Formula | C22H23FN4O2S |
| Molecular Weight | 426.52 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | 1-(5-fluoro-1,3-benzothiazol-2-yl)-3-[(9R,13S)-4-hydroxy-1,10-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-13-yl]urea |
| SMILES | CN1CCC2(C)c3cc(O)ccc3C[C@@H]1[C@H]2NC(=O)Nc1nc2cc(F)ccc2s1 |
| InChI | InChI=1S/C22H23FN4O2S/c1-22-7-8-27(2)17(9-12-3-5-14(28)11-15(12)22)19(22)25-20(29)26-21-24-16-10-13(23)4-6-18(16)30-21/h3-6,10-11,17,19,28H,7-9H2,1-2H3,(H2,24,25,26,29)/t17-,19-,22?/m1/s1 |
| InChIKey | CJEXIBRABHTSDC-ZSQVXAAVSA-N |
| XLogP | 3.85 |
| TPSA | 77.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.52 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |