C23H26N4O2 — CID 126690872
1-[4-(2H-azirin-2-yl)phenyl]-3-[(1S,9R,13R)-4-hydroxy-1,10-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-13-yl]urea (PubChem CID 126690872) has the molecular formula C23H26N4O2 and a molecular weight of 390.49 g/mol. Its IUPAC name is 1-[4-(2H-azirin-2-yl)phenyl]-3-[(1S,9R,13R)-4-hydroxy-1,10-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-13-yl]urea.
| Compound Name | 1-[4-(2H-azirin-2-yl)phenyl]-3-[(1S,9R,13R)-4-hydroxy-1,10-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-13-yl]urea |
|---|---|
| PubChem CID | 126690872 |
| Molecular Formula | C23H26N4O2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | 1-[4-(2H-azirin-2-yl)phenyl]-3-[(1S,9R,13R)-4-hydroxy-1,10-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-13-yl]urea |
| SMILES | CN1CC[C@@]2(C)c3cc(O)ccc3C[C@@H]1[C@@H]2NC(=O)Nc1ccc(C2C=N2)cc1 |
| InChI | InChI=1S/C23H26N4O2/c1-23-9-10-27(2)20(11-15-5-8-17(28)12-18(15)23)21(23)26-22(29)25-16-6-3-14(4-7-16)19-13-24-19/h3-8,12-13,19-21,28H,9-11H2,1-2H3,(H2,25,26,29)/t19?,20-,21+,23+/m1/s1 |
| InChIKey | PXZGPKBRBBARDF-VEPKZSNGSA-N |
| XLogP | 3.23 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |