C23H26N4O2 — CID 90148761
3-(4-cyanophenyl)-1-[(1R,13S)-4-hydroxy-1,10-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-13-yl]-1-methylurea (PubChem CID 90148761) has the molecular formula C23H26N4O2 and a molecular weight of 390.49 g/mol. Its IUPAC name is 3-(4-cyanophenyl)-1-[(1R,13S)-4-hydroxy-1,10-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-13-yl]-1-methylurea.
| Compound Name | 3-(4-cyanophenyl)-1-[(1R,13S)-4-hydroxy-1,10-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-13-yl]-1-methylurea |
|---|---|
| PubChem CID | 90148761 |
| Molecular Formula | C23H26N4O2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | 3-(4-cyanophenyl)-1-[(1R,13S)-4-hydroxy-1,10-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-13-yl]-1-methylurea |
| SMILES | CN1CC[C@]2(C)c3cc(O)ccc3CC1[C@H]2N(C)C(=O)Nc1ccc(C#N)cc1 |
| InChI | InChI=1S/C23H26N4O2/c1-23-10-11-26(2)20(12-16-6-9-18(28)13-19(16)23)21(23)27(3)22(29)25-17-7-4-15(14-24)5-8-17/h4-9,13,20-21,28H,10-12H2,1-3H3,(H,25,29)/t20?,21-,23-/m1/s1 |
| InChIKey | AUURJDKBGHLXJS-CQQDSARBSA-N |
| XLogP | 3.31 |
| TPSA | 79.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |