C25H41N3O2 — CID 126665232
(1S,9R,13R)-13-[[1-(2-hydroxy-2-methylpropyl)piperidin-4-yl]methyl-methylamino]-1,10-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol (PubChem CID 126665232) has the molecular formula C25H41N3O2 and a molecular weight of 415.62 g/mol. Its IUPAC name is (1S,9R,13R)-13-[[1-(2-hydroxy-2-methylpropyl)piperidin-4-yl]methyl-methylamino]-1,10-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol.
| Compound Name | (1S,9R,13R)-13-[[1-(2-hydroxy-2-methylpropyl)piperidin-4-yl]methyl-methylamino]-1,10-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol |
|---|---|
| PubChem CID | 126665232 |
| Molecular Formula | C25H41N3O2 |
| Molecular Weight | 415.62 g/mol |
| Exact Mass | 415.32 |
| IUPAC Name | (1S,9R,13R)-13-[[1-(2-hydroxy-2-methylpropyl)piperidin-4-yl]methyl-methylamino]-1,10-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol |
| SMILES | CN1CC[C@@]2(C)c3cc(O)ccc3C[C@@H]1[C@@H]2N(C)CC1CCN(CC(C)(C)O)CC1 |
| InChI | InChI=1S/C25H41N3O2/c1-24(2,30)17-28-11-8-18(9-12-28)16-27(5)23-22-14-19-6-7-20(29)15-21(19)25(23,3)10-13-26(22)4/h6-7,15,18,22-23,29-30H,8-14,16-17H2,1-5H3/t22-,23+,25+/m1/s1 |
| InChIKey | RFDYJCVLXPPHID-CUYJMHBOSA-N |
| XLogP | 2.69 |
| TPSA | 50.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.62 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |