C27H42N2O3 — CID 144623296
tert-butyl 4-[[[(1R,9S,13S)-4-hydroxy-1,10-dimethyl-13-tricyclo[7.3.1.02,7]trideca-2(7),3,5-trienyl]-methylamino]methyl]piperidine-1-carboxylate (PubChem CID 144623296) has the molecular formula C27H42N2O3 and a molecular weight of 442.64 g/mol. Its IUPAC name is tert-butyl 4-[[[(1R,9S,13S)-4-hydroxy-1,10-dimethyl-13-tricyclo[7.3.1.02,7]trideca-2(7),3,5-trienyl]-methylamino]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[[(1R,9S,13S)-4-hydroxy-1,10-dimethyl-13-tricyclo[7.3.1.02,7]trideca-2(7),3,5-trienyl]-methylamino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 144623296 |
| Molecular Formula | C27H42N2O3 |
| Molecular Weight | 442.64 g/mol |
| Exact Mass | 442.32 |
| IUPAC Name | tert-butyl 4-[[[(1R,9S,13S)-4-hydroxy-1,10-dimethyl-13-tricyclo[7.3.1.02,7]trideca-2(7),3,5-trienyl]-methylamino]methyl]piperidine-1-carboxylate |
| SMILES | CC1CC[C@]2(C)c3cc(O)ccc3C[C@@H]1[C@@H]2N(C)CC1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C27H42N2O3/c1-18-9-12-27(5)23-16-21(30)8-7-20(23)15-22(18)24(27)28(6)17-19-10-13-29(14-11-19)25(31)32-26(2,3)4/h7-8,16,18-19,22,24,30H,9-15,17H2,1-6H3/t18?,22-,24-,27+/m0/s1 |
| InChIKey | AKVPGYJQGQYSAB-WHYOKNOCSA-N |
| XLogP | 5.20 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.64 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |