C29H45N3O4 — CID 90148688
tert-butyl 4-[[[(1R,13S)-1,10-dimethyl-4-(2-methylpropanoyloxy)-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-13-yl]amino]methyl]piperidine-1-carboxylate (PubChem CID 90148688) has the molecular formula C29H45N3O4 and a molecular weight of 499.70 g/mol. Its IUPAC name is tert-butyl 4-[[[(1R,13S)-1,10-dimethyl-4-(2-methylpropanoyloxy)-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-13-yl]amino]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[[(1R,13S)-1,10-dimethyl-4-(2-methylpropanoyloxy)-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-13-yl]amino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 90148688 |
| Molecular Formula | C29H45N3O4 |
| Molecular Weight | 499.70 g/mol |
| Exact Mass | 499.34 |
| IUPAC Name | tert-butyl 4-[[[(1R,13S)-1,10-dimethyl-4-(2-methylpropanoyloxy)-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-13-yl]amino]methyl]piperidine-1-carboxylate |
| SMILES | CC(C)C(=O)Oc1ccc2c(c1)[C@@]1(C)CCN(C)C(C2)[C@H]1NCC1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C29H45N3O4/c1-19(2)26(33)35-22-9-8-21-16-24-25(29(6,23(21)17-22)12-15-31(24)7)30-18-20-10-13-32(14-11-20)27(34)36-28(3,4)5/h8-9,17,19-20,24-25,30H,10-16,18H2,1-7H3/t24?,25-,29-/m1/s1 |
| InChIKey | WZZODGDWSWMDJC-FGBHTTSXSA-N |
| XLogP | 4.37 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.70 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|