C25H39N3O3 — CID 90123043
tert-butyl 4-[[[(1S,9R,13S)-4-hydroxy-1,10-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-13-yl]amino]methyl]piperidine-1-carboxylate (PubChem CID 90123043) has the molecular formula C25H39N3O3 and a molecular weight of 429.61 g/mol. Its IUPAC name is tert-butyl 4-[[[(1S,9R,13S)-4-hydroxy-1,10-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-13-yl]amino]methyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[[(1S,9R,13S)-4-hydroxy-1,10-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-13-yl]amino]methyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 90123043 |
| Molecular Formula | C25H39N3O3 |
| Molecular Weight | 429.61 g/mol |
| Exact Mass | 429.30 |
| IUPAC Name | tert-butyl 4-[[[(1S,9R,13S)-4-hydroxy-1,10-dimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-13-yl]amino]methyl]piperidine-1-carboxylate |
| SMILES | CN1CC[C@@]2(C)c3cc(O)ccc3C[C@@H]1[C@H]2NCC1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C25H39N3O3/c1-24(2,3)31-23(30)28-11-8-17(9-12-28)16-26-22-21-14-18-6-7-19(29)15-20(18)25(22,4)10-13-27(21)5/h6-7,15,17,21-22,26,29H,8-14,16H2,1-5H3/t21-,22-,25+/m1/s1 |
| InChIKey | PFZYLDOFUQAZCV-RQTOMXEWSA-N |
| XLogP | 3.52 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.61 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |