C23H35N3O — CID 90123198
(1S,9R,13S)-10-(cyclopropylmethyl)-1-methyl-13-(piperidin-4-ylmethylamino)-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol (PubChem CID 90123198) has the molecular formula C23H35N3O and a molecular weight of 369.55 g/mol. Its IUPAC name is (1S,9R,13S)-10-(cyclopropylmethyl)-1-methyl-13-(piperidin-4-ylmethylamino)-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol.
| Compound Name | (1S,9R,13S)-10-(cyclopropylmethyl)-1-methyl-13-(piperidin-4-ylmethylamino)-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol |
|---|---|
| PubChem CID | 90123198 |
| Molecular Formula | C23H35N3O |
| Molecular Weight | 369.55 g/mol |
| Exact Mass | 369.28 |
| IUPAC Name | (1S,9R,13S)-10-(cyclopropylmethyl)-1-methyl-13-(piperidin-4-ylmethylamino)-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol |
| SMILES | C[C@]12CCN(CC3CC3)[C@H](Cc3ccc(O)cc31)[C@H]2NCC1CCNCC1 |
| InChI | InChI=1S/C23H35N3O/c1-23-8-11-26(15-17-2-3-17)21(12-18-4-5-19(27)13-20(18)23)22(23)25-14-16-6-9-24-10-7-16/h4-5,13,16-17,21-22,24-25,27H,2-3,6-12,14-15H2,1H3/t21-,22-,23+/m1/s1 |
| InChIKey | LDHOPIZYEMVABY-ZLNRFVROSA-N |
| XLogP | 2.65 |
| TPSA | 47.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.55 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |