C19H28N2 — CID 159173291
(1S,9R,13R)-10-(cyclopropylmethyl)-N,1,4-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-13-amine (PubChem CID 159173291) has the molecular formula C19H28N2 and a molecular weight of 284.45 g/mol. Its IUPAC name is (1S,9R,13R)-10-(cyclopropylmethyl)-N,1,4-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-13-amine.
| Compound Name | (1S,9R,13R)-10-(cyclopropylmethyl)-N,1,4-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-13-amine |
|---|---|
| PubChem CID | 159173291 |
| Molecular Formula | C19H28N2 |
| Molecular Weight | 284.45 g/mol |
| Exact Mass | 284.23 |
| IUPAC Name | (1S,9R,13R)-10-(cyclopropylmethyl)-N,1,4-trimethyl-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-13-amine |
| SMILES | CN[C@H]1[C@H]2Cc3ccc(C)cc3[C@]1(C)CCN2CC1CC1 |
| InChI | InChI=1S/C19H28N2/c1-13-4-7-15-11-17-18(20-3)19(2,16(15)10-13)8-9-21(17)12-14-5-6-14/h4,7,10,14,17-18,20H,5-6,8-9,11-12H2,1-3H3/t17-,18+,19+/m1/s1 |
| InChIKey | VNMCYHZFUKUKBD-QYZOEREBSA-N |
| XLogP | 2.88 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.45 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |