C20H26N2OS — CID 90123232
(1S,9R,13R)-1,10-dimethyl-13-(2-thiophen-2-ylethylamino)-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol (PubChem CID 90123232) has the molecular formula C20H26N2OS and a molecular weight of 342.51 g/mol. Its IUPAC name is (1S,9R,13R)-1,10-dimethyl-13-(2-thiophen-2-ylethylamino)-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol.
| Compound Name | (1S,9R,13R)-1,10-dimethyl-13-(2-thiophen-2-ylethylamino)-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol |
|---|---|
| PubChem CID | 90123232 |
| Molecular Formula | C20H26N2OS |
| Molecular Weight | 342.51 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | (1S,9R,13R)-1,10-dimethyl-13-(2-thiophen-2-ylethylamino)-10-azatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-4-ol |
| SMILES | CN1CC[C@@]2(C)c3cc(O)ccc3C[C@@H]1[C@@H]2NCCc1cccs1 |
| InChI | InChI=1S/C20H26N2OS/c1-20-8-10-22(2)18(12-14-5-6-15(23)13-17(14)20)19(20)21-9-7-16-4-3-11-24-16/h3-6,11,13,18-19,21,23H,7-10,12H2,1-2H3/t18-,19+,20+/m1/s1 |
| InChIKey | OXIMUDJGYSBWOR-AABGKKOBSA-N |
| XLogP | 3.17 |
| TPSA | 35.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.51 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |