C20H26N2S — CID 134592267
(1R,9R,13R)-1,10-dimethyl-N-(2-thiophen-2-ylethyl)-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-13-amine (PubChem CID 134592267) has the molecular formula C20H26N2S and a molecular weight of 326.51 g/mol. Its IUPAC name is (1R,9R,13R)-1,10-dimethyl-N-(2-thiophen-2-ylethyl)-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-13-amine.
| Compound Name | (1R,9R,13R)-1,10-dimethyl-N-(2-thiophen-2-ylethyl)-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-13-amine |
|---|---|
| PubChem CID | 134592267 |
| Molecular Formula | C20H26N2S |
| Molecular Weight | 326.51 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | (1R,9R,13R)-1,10-dimethyl-N-(2-thiophen-2-ylethyl)-10-azatricyclo[7.3.1.02,7]trideca-2,4,6-trien-13-amine |
| SMILES | CN1CC[C@]2(C)c3ccccc3C[C@@H]1[C@@H]2NCCc1cccs1 |
| InChI | InChI=1S/C20H26N2S/c1-20-10-12-22(2)18(14-15-6-3-4-8-17(15)20)19(20)21-11-9-16-7-5-13-23-16/h3-8,13,18-19,21H,9-12,14H2,1-2H3/t18-,19+,20-/m1/s1 |
| InChIKey | DUHKWUNOZYOVLZ-HSALFYBXSA-N |
| XLogP | 3.47 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.51 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |