About N-[(1,4-dimethylpiperidin-4-yl)methyl]-1-thiophen-2-ylmethanamine
N-[(1,4-dimethylpiperidin-4-yl)methyl]-1-thiophen-2-ylmethanamine (PubChem CID 103992175) has the molecular formula C13H22N2S
and a molecular weight of 238.40 g/mol. Its IUPAC name is N-[(1,4-dimethylpiperidin-4-yl)methyl]-1-thiophen-2-ylmethanamine.
Molecular Properties
| Compound Name | N-[(1,4-dimethylpiperidin-4-yl)methyl]-1-thiophen-2-ylmethanamine |
| PubChem CID | 103992175 |
| Molecular Formula | C13H22N2S |
| Molecular Weight | 238.40 g/mol |
| Exact Mass | 238.15 |
| IUPAC Name | N-[(1,4-dimethylpiperidin-4-yl)methyl]-1-thiophen-2-ylmethanamine |
| SMILES | CN1CCC(C)(CNCc2cccs2)CC1 |
| InChI | InChI=1S/C13H22N2S/c1-13(5-7-15(2)8-6-13)11-14-10-12-4-3-9-16-12/h3-4,9,14H,5-8,10-11H2,1-2H3 |
| InChIKey | IRFGZZHWALBDND-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.40 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(1,4-dimethylpiperidin-4-yl)methyl]-1-thiophen-2-ylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1,4-dimethylpiperidin-4-yl)methyl]-1-thiophen-2-ylmethanamine?
The IUPAC name of N-[(1,4-dimethylpiperidin-4-yl)methyl]-1-thiophen-2-ylmethanamine (CID 103992175) is N-[(1,4-dimethylpiperidin-4-yl)methyl]-1-thiophen-2-ylmethanamine.
What is the SMILES notation for N-[(1,4-dimethylpiperidin-4-yl)methyl]-1-thiophen-2-ylmethanamine?
The canonical SMILES for N-[(1,4-dimethylpiperidin-4-yl)methyl]-1-thiophen-2-ylmethanamine is CN1CCC(C)(CNCc2cccs2)CC1.
What is the InChIKey of N-[(1,4-dimethylpiperidin-4-yl)methyl]-1-thiophen-2-ylmethanamine?
The InChIKey is IRFGZZHWALBDND-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N2S/c1-13(5-7-15(2)8-6-13)11-14-10-12-4-3-9-16-12/h3-4,9,14H,5-8,10-11H2,1-2H3.
What are the key properties of N-[(1,4-dimethylpiperidin-4-yl)methyl]-1-thiophen-2-ylmethanamine?
N-[(1,4-dimethylpiperidin-4-yl)methyl]-1-thiophen-2-ylmethanamine has a molecular weight of 238.40 g/mol, XLogP of 2.57, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1,4-dimethylpiperidin-4-yl)methyl]-1-thiophen-2-ylmethanamine is sourced from PubChem (CID 103992175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).