C13H9FN4O3S — CID 18102054
N-(6-fluoro-1,3-benzothiazol-2-yl)-1-methyl-4-nitropyrrole-2-carboxamide (PubChem CID 18102054) has the molecular formula C13H9FN4O3S and a molecular weight of 320.31 g/mol. Its IUPAC name is N-(6-fluoro-1,3-benzothiazol-2-yl)-1-methyl-4-nitropyrrole-2-carboxamide.
| Compound Name | N-(6-fluoro-1,3-benzothiazol-2-yl)-1-methyl-4-nitropyrrole-2-carboxamide |
|---|---|
| PubChem CID | 18102054 |
| Molecular Formula | C13H9FN4O3S |
| Molecular Weight | 320.31 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | N-(6-fluoro-1,3-benzothiazol-2-yl)-1-methyl-4-nitropyrrole-2-carboxamide |
| SMILES | Cn1cc([N+](=O)[O-])cc1C(=O)Nc1nc2ccc(F)cc2s1 |
| InChI | InChI=1S/C13H9FN4O3S/c1-17-6-8(18(20)21)5-10(17)12(19)16-13-15-9-3-2-7(14)4-11(9)22-13/h2-6H,1H3,(H,15,16,19) |
| InChIKey | HYIVTDILPJQIIH-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 90.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.31 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|