C12H13N5O3S — CID 43593354
1-methyl-4-nitro-N-(4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)pyrrole-2-carboxamide (PubChem CID 43593354) has the molecular formula C12H13N5O3S and a molecular weight of 307.33 g/mol. Its IUPAC name is 1-methyl-4-nitro-N-(4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)pyrrole-2-carboxamide.
| Compound Name | 1-methyl-4-nitro-N-(4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 43593354 |
| Molecular Formula | C12H13N5O3S |
| Molecular Weight | 307.33 g/mol |
| Exact Mass | 307.07 |
| IUPAC Name | 1-methyl-4-nitro-N-(4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)pyrrole-2-carboxamide |
| SMILES | Cn1cc([N+](=O)[O-])cc1C(=O)Nc1nc2c(s1)CNCC2 |
| InChI | InChI=1S/C12H13N5O3S/c1-16-6-7(17(19)20)4-9(16)11(18)15-12-14-8-2-3-13-5-10(8)21-12/h4,6,13H,2-3,5H2,1H3,(H,14,15,18) |
| InChIKey | FJCFOTKUECOJKS-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 102.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.33 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|