C15H14N4O5S — CID 166194824
methyl 3-nitro-5-(4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-ylcarbamoyl)benzoate (PubChem CID 166194824) has the molecular formula C15H14N4O5S and a molecular weight of 362.37 g/mol. Its IUPAC name is methyl 3-nitro-5-(4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-ylcarbamoyl)benzoate.
| Compound Name | methyl 3-nitro-5-(4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-ylcarbamoyl)benzoate |
|---|---|
| PubChem CID | 166194824 |
| Molecular Formula | C15H14N4O5S |
| Molecular Weight | 362.37 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | methyl 3-nitro-5-(4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-ylcarbamoyl)benzoate |
| SMILES | COC(=O)c1cc(C(=O)Nc2nc3c(s2)CNCC3)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C15H14N4O5S/c1-24-14(21)9-4-8(5-10(6-9)19(22)23)13(20)18-15-17-11-2-3-16-7-12(11)25-15/h4-6,16H,2-3,7H2,1H3,(H,17,18,20) |
| InChIKey | QDIHQUWMNJUDRQ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 123.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.37 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|