C14H13N3O3S2 — CID 167784663
N-(6,7-dihydro-4H-thiopyrano[4,3-d][1,3]thiazol-2-yl)-3-methyl-5-nitrobenzamide (PubChem CID 167784663) has the molecular formula C14H13N3O3S2 and a molecular weight of 335.41 g/mol. Its IUPAC name is N-(6,7-dihydro-4H-thiopyrano[4,3-d][1,3]thiazol-2-yl)-3-methyl-5-nitrobenzamide.
| Compound Name | N-(6,7-dihydro-4H-thiopyrano[4,3-d][1,3]thiazol-2-yl)-3-methyl-5-nitrobenzamide |
|---|---|
| PubChem CID | 167784663 |
| Molecular Formula | C14H13N3O3S2 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.04 |
| IUPAC Name | N-(6,7-dihydro-4H-thiopyrano[4,3-d][1,3]thiazol-2-yl)-3-methyl-5-nitrobenzamide |
| SMILES | Cc1cc(C(=O)Nc2nc3c(s2)CSCC3)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H13N3O3S2/c1-8-4-9(6-10(5-8)17(19)20)13(18)16-14-15-11-2-3-21-7-12(11)22-14/h4-6H,2-3,7H2,1H3,(H,15,16,18) |
| InChIKey | ABRIBVUYULWPBK-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|