C13H12Cl2N4OS — CID 107653982
1-(3,5-dichlorophenyl)-3-(4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)urea (PubChem CID 107653982) has the molecular formula C13H12Cl2N4OS and a molecular weight of 343.24 g/mol. Its IUPAC name is 1-(3,5-dichlorophenyl)-3-(4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)urea.
| Compound Name | 1-(3,5-dichlorophenyl)-3-(4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)urea |
|---|---|
| PubChem CID | 107653982 |
| Molecular Formula | C13H12Cl2N4OS |
| Molecular Weight | 343.24 g/mol |
| Exact Mass | 342.01 |
| IUPAC Name | 1-(3,5-dichlorophenyl)-3-(4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)urea |
| SMILES | O=C(Nc1cc(Cl)cc(Cl)c1)Nc1nc2c(s1)CNCC2 |
| InChI | InChI=1S/C13H12Cl2N4OS/c14-7-3-8(15)5-9(4-7)17-12(20)19-13-18-10-1-2-16-6-11(10)21-13/h3-5,16H,1-2,6H2,(H2,17,18,19,20) |
| InChIKey | MQRROGJSUYVYSA-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.24 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |