C11H12N4OS2 — CID 65199010
2-methyl-N-(4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)-1,3-thiazole-4-carboxamide (PubChem CID 65199010) has the molecular formula C11H12N4OS2 and a molecular weight of 280.38 g/mol. Its IUPAC name is 2-methyl-N-(4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)-1,3-thiazole-4-carboxamide.
| Compound Name | 2-methyl-N-(4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 65199010 |
| Molecular Formula | C11H12N4OS2 |
| Molecular Weight | 280.38 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | 2-methyl-N-(4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)-1,3-thiazole-4-carboxamide |
| SMILES | Cc1nc(C(=O)Nc2nc3c(s2)CNCC3)cs1 |
| InChI | InChI=1S/C11H12N4OS2/c1-6-13-8(5-17-6)10(16)15-11-14-7-2-3-12-4-9(7)18-11/h5,12H,2-4H2,1H3,(H,14,15,16) |
| InChIKey | PVTXCPVWMKEHIL-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.38 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |