C11H15N3OS — CID 43593365
3-methyl-N-(4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)but-2-enamide (PubChem CID 43593365) has the molecular formula C11H15N3OS and a molecular weight of 237.33 g/mol. Its IUPAC name is 3-methyl-N-(4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)but-2-enamide.
| Compound Name | 3-methyl-N-(4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)but-2-enamide |
|---|---|
| PubChem CID | 43593365 |
| Molecular Formula | C11H15N3OS |
| Molecular Weight | 237.33 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | 3-methyl-N-(4,5,6,7-tetrahydro-[1,3]thiazolo[5,4-c]pyridin-2-yl)but-2-enamide |
| SMILES | CC(C)=CC(=O)Nc1nc2c(s1)CNCC2 |
| InChI | InChI=1S/C11H15N3OS/c1-7(2)5-10(15)14-11-13-8-3-4-12-6-9(8)16-11/h5,12H,3-4,6H2,1-2H3,(H,13,14,15) |
| InChIKey | JCSQZDXQAZEIOJ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.33 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|