C15H11FN2OS2 — CID 7565106
N-(6-fluoro-1,3-benzothiazol-2-yl)-3-methylsulfanylbenzamide (PubChem CID 7565106) has the molecular formula C15H11FN2OS2 and a molecular weight of 318.40 g/mol. Its IUPAC name is N-(6-fluoro-1,3-benzothiazol-2-yl)-3-methylsulfanylbenzamide.
| Compound Name | N-(6-fluoro-1,3-benzothiazol-2-yl)-3-methylsulfanylbenzamide |
|---|---|
| PubChem CID | 7565106 |
| Molecular Formula | C15H11FN2OS2 |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | N-(6-fluoro-1,3-benzothiazol-2-yl)-3-methylsulfanylbenzamide |
| SMILES | CSc1cccc(C(=O)Nc2nc3ccc(F)cc3s2)c1 |
| InChI | InChI=1S/C15H11FN2OS2/c1-20-11-4-2-3-9(7-11)14(19)18-15-17-12-6-5-10(16)8-13(12)21-15/h2-8H,1H3,(H,17,18,19) |
| InChIKey | NDZJSTUQIFKLFN-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |