C18H17FN2OS — CID 53269170
N-(6-butan-2-yl-1,3-benzothiazol-2-yl)-3-fluorobenzamide (PubChem CID 53269170) has the molecular formula C18H17FN2OS and a molecular weight of 328.41 g/mol. Its IUPAC name is N-(6-butan-2-yl-1,3-benzothiazol-2-yl)-3-fluorobenzamide.
| Compound Name | N-(6-butan-2-yl-1,3-benzothiazol-2-yl)-3-fluorobenzamide |
|---|---|
| PubChem CID | 53269170 |
| Molecular Formula | C18H17FN2OS |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.10 |
| IUPAC Name | N-(6-butan-2-yl-1,3-benzothiazol-2-yl)-3-fluorobenzamide |
| SMILES | CCC(C)c1ccc2nc(NC(=O)c3cccc(F)c3)sc2c1 |
| InChI | InChI=1S/C18H17FN2OS/c1-3-11(2)12-7-8-15-16(10-12)23-18(20-15)21-17(22)13-5-4-6-14(19)9-13/h4-11H,3H2,1-2H3,(H,20,21,22) |
| InChIKey | YLCDCYZAHZAOFX-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |