C18H24N2OS — CID 53269216
N-(6-butan-2-yl-1,3-benzothiazol-2-yl)cyclohexanecarboxamide (PubChem CID 53269216) has the molecular formula C18H24N2OS and a molecular weight of 316.47 g/mol. Its IUPAC name is N-(6-butan-2-yl-1,3-benzothiazol-2-yl)cyclohexanecarboxamide.
| Compound Name | N-(6-butan-2-yl-1,3-benzothiazol-2-yl)cyclohexanecarboxamide |
|---|---|
| PubChem CID | 53269216 |
| Molecular Formula | C18H24N2OS |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | N-(6-butan-2-yl-1,3-benzothiazol-2-yl)cyclohexanecarboxamide |
| SMILES | CCC(C)c1ccc2nc(NC(=O)C3CCCCC3)sc2c1 |
| InChI | InChI=1S/C18H24N2OS/c1-3-12(2)14-9-10-15-16(11-14)22-18(19-15)20-17(21)13-7-5-4-6-8-13/h9-13H,3-8H2,1-2H3,(H,19,20,21) |
| InChIKey | MFVUEHFDLXHSHF-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |