C14H17ClN2OS — CID 28662068
(2R)-N-[6-[(2S)-butan-2-yl]-1,3-benzothiazol-2-yl]-2-chloropropanamide (PubChem CID 28662068) has the molecular formula C14H17ClN2OS and a molecular weight of 296.82 g/mol. Its IUPAC name is (2R)-N-[6-[(2S)-butan-2-yl]-1,3-benzothiazol-2-yl]-2-chloropropanamide.
| Compound Name | (2R)-N-[6-[(2S)-butan-2-yl]-1,3-benzothiazol-2-yl]-2-chloropropanamide |
|---|---|
| PubChem CID | 28662068 |
| Molecular Formula | C14H17ClN2OS |
| Molecular Weight | 296.82 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | (2R)-N-[6-[(2S)-butan-2-yl]-1,3-benzothiazol-2-yl]-2-chloropropanamide |
| SMILES | CC[C@H](C)c1ccc2nc(NC(=O)[C@@H](C)Cl)sc2c1 |
| InChI | InChI=1S/C14H17ClN2OS/c1-4-8(2)10-5-6-11-12(7-10)19-14(16-11)17-13(18)9(3)15/h5-9H,4H2,1-3H3,(H,16,17,18)/t8-,9+/m0/s1 |
| InChIKey | QAOYDKQCIXCSML-DTWKUNHWSA-N |
| XLogP | 4.38 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.82 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|