C12H13ClN2OS — CID 28661952
(2S)-2-chloro-N-(5,6-dimethyl-1,3-benzothiazol-2-yl)propanamide (PubChem CID 28661952) has the molecular formula C12H13ClN2OS and a molecular weight of 268.77 g/mol. Its IUPAC name is (2S)-2-chloro-N-(5,6-dimethyl-1,3-benzothiazol-2-yl)propanamide.
| Compound Name | (2S)-2-chloro-N-(5,6-dimethyl-1,3-benzothiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 28661952 |
| Molecular Formula | C12H13ClN2OS |
| Molecular Weight | 268.77 g/mol |
| Exact Mass | 268.04 |
| IUPAC Name | (2S)-2-chloro-N-(5,6-dimethyl-1,3-benzothiazol-2-yl)propanamide |
| SMILES | Cc1cc2nc(NC(=O)[C@H](C)Cl)sc2cc1C |
| InChI | InChI=1S/C12H13ClN2OS/c1-6-4-9-10(5-7(6)2)17-12(14-9)15-11(16)8(3)13/h4-5,8H,1-3H3,(H,14,15,16)/t8-/m0/s1 |
| InChIKey | KKLSIDQOGOHJBH-QMMMGPOBSA-N |
| XLogP | 3.48 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.77 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|