C10H7BrCl2N2OS — CID 28662008
(2S)-N-(4-bromo-6-chloro-1,3-benzothiazol-2-yl)-2-chloropropanamide (PubChem CID 28662008) has the molecular formula C10H7BrCl2N2OS and a molecular weight of 354.06 g/mol. Its IUPAC name is (2S)-N-(4-bromo-6-chloro-1,3-benzothiazol-2-yl)-2-chloropropanamide.
| Compound Name | (2S)-N-(4-bromo-6-chloro-1,3-benzothiazol-2-yl)-2-chloropropanamide |
|---|---|
| PubChem CID | 28662008 |
| Molecular Formula | C10H7BrCl2N2OS |
| Molecular Weight | 354.06 g/mol |
| Exact Mass | 351.88 |
| IUPAC Name | (2S)-N-(4-bromo-6-chloro-1,3-benzothiazol-2-yl)-2-chloropropanamide |
| SMILES | C[C@H](Cl)C(=O)Nc1nc2c(Br)cc(Cl)cc2s1 |
| InChI | InChI=1S/C10H7BrCl2N2OS/c1-4(12)9(16)15-10-14-8-6(11)2-5(13)3-7(8)17-10/h2-4H,1H3,(H,14,15,16)/t4-/m0/s1 |
| InChIKey | LSONRFXDUVCBDA-BYPYZUCNSA-N |
| XLogP | 4.28 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.06 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|