C15H18BrClN2OS — CID 17244777
2-bromo-N-(6-chloro-4-ethyl-1,3-benzothiazol-2-yl)hexanamide (PubChem CID 17244777) has the molecular formula C15H18BrClN2OS and a molecular weight of 389.75 g/mol. Its IUPAC name is 2-bromo-N-(6-chloro-4-ethyl-1,3-benzothiazol-2-yl)hexanamide.
| Compound Name | 2-bromo-N-(6-chloro-4-ethyl-1,3-benzothiazol-2-yl)hexanamide |
|---|---|
| PubChem CID | 17244777 |
| Molecular Formula | C15H18BrClN2OS |
| Molecular Weight | 389.75 g/mol |
| Exact Mass | 388.00 |
| IUPAC Name | 2-bromo-N-(6-chloro-4-ethyl-1,3-benzothiazol-2-yl)hexanamide |
| SMILES | CCCCC(Br)C(=O)Nc1nc2c(CC)cc(Cl)cc2s1 |
| InChI | InChI=1S/C15H18BrClN2OS/c1-3-5-6-11(16)14(20)19-15-18-13-9(4-2)7-10(17)8-12(13)21-15/h7-8,11H,3-6H2,1-2H3,(H,18,19,20) |
| InChIKey | NBDIEZHDGAXMNQ-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.75 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|