C12H12BrClN2OS — CID 28662156
(2R)-2-bromo-N-(6-chloro-4-methyl-1,3-benzothiazol-2-yl)butanamide (PubChem CID 28662156) has the molecular formula C12H12BrClN2OS and a molecular weight of 347.67 g/mol. Its IUPAC name is (2R)-2-bromo-N-(6-chloro-4-methyl-1,3-benzothiazol-2-yl)butanamide.
| Compound Name | (2R)-2-bromo-N-(6-chloro-4-methyl-1,3-benzothiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 28662156 |
| Molecular Formula | C12H12BrClN2OS |
| Molecular Weight | 347.67 g/mol |
| Exact Mass | 345.95 |
| IUPAC Name | (2R)-2-bromo-N-(6-chloro-4-methyl-1,3-benzothiazol-2-yl)butanamide |
| SMILES | CC[C@@H](Br)C(=O)Nc1nc2c(C)cc(Cl)cc2s1 |
| InChI | InChI=1S/C12H12BrClN2OS/c1-3-8(13)11(17)16-12-15-10-6(2)4-7(14)5-9(10)18-12/h4-5,8H,3H2,1-2H3,(H,15,16,17)/t8-/m1/s1 |
| InChIKey | YRESHZRMXQSDLJ-MRVPVSSYSA-N |
| XLogP | 4.37 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.67 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|