C11H9Br2FN2OS — CID 28662257
(2R)-2-bromo-N-(6-bromo-4-fluoro-1,3-benzothiazol-2-yl)butanamide (PubChem CID 28662257) has the molecular formula C11H9Br2FN2OS and a molecular weight of 396.08 g/mol. Its IUPAC name is (2R)-2-bromo-N-(6-bromo-4-fluoro-1,3-benzothiazol-2-yl)butanamide.
| Compound Name | (2R)-2-bromo-N-(6-bromo-4-fluoro-1,3-benzothiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 28662257 |
| Molecular Formula | C11H9Br2FN2OS |
| Molecular Weight | 396.08 g/mol |
| Exact Mass | 393.88 |
| IUPAC Name | (2R)-2-bromo-N-(6-bromo-4-fluoro-1,3-benzothiazol-2-yl)butanamide |
| SMILES | CC[C@@H](Br)C(=O)Nc1nc2c(F)cc(Br)cc2s1 |
| InChI | InChI=1S/C11H9Br2FN2OS/c1-2-6(13)10(17)16-11-15-9-7(14)3-5(12)4-8(9)18-11/h3-4,6H,2H2,1H3,(H,15,16,17)/t6-/m1/s1 |
| InChIKey | GXDWDLLNMGQHDM-ZCFIWIBFSA-N |
| XLogP | 4.31 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.08 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|