C14H16Br2N2OS — CID 28662435
(2S)-2-bromo-N-(4-bromo-6,7-dimethyl-1,3-benzothiazol-2-yl)pentanamide (PubChem CID 28662435) has the molecular formula C14H16Br2N2OS and a molecular weight of 420.17 g/mol. Its IUPAC name is (2S)-2-bromo-N-(4-bromo-6,7-dimethyl-1,3-benzothiazol-2-yl)pentanamide.
| Compound Name | (2S)-2-bromo-N-(4-bromo-6,7-dimethyl-1,3-benzothiazol-2-yl)pentanamide |
|---|---|
| PubChem CID | 28662435 |
| Molecular Formula | C14H16Br2N2OS |
| Molecular Weight | 420.17 g/mol |
| Exact Mass | 417.94 |
| IUPAC Name | (2S)-2-bromo-N-(4-bromo-6,7-dimethyl-1,3-benzothiazol-2-yl)pentanamide |
| SMILES | CCC[C@H](Br)C(=O)Nc1nc2c(Br)cc(C)c(C)c2s1 |
| InChI | InChI=1S/C14H16Br2N2OS/c1-4-5-9(15)13(19)18-14-17-11-10(16)6-7(2)8(3)12(11)20-14/h6,9H,4-5H2,1-3H3,(H,17,18,19)/t9-/m0/s1 |
| InChIKey | OOZTXKIOJJKDSS-VIFPVBQESA-N |
| XLogP | 5.18 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.17 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|