C24H32N2O — CID 57291620
N,N-dimethyl-4-(2-methylpiperidin-1-yl)-2,2-diphenylbutanamide (PubChem CID 57291620) has the molecular formula C24H32N2O and a molecular weight of 364.53 g/mol. Its IUPAC name is N,N-dimethyl-4-(2-methylpiperidin-1-yl)-2,2-diphenylbutanamide.
| Compound Name | N,N-dimethyl-4-(2-methylpiperidin-1-yl)-2,2-diphenylbutanamide |
|---|---|
| PubChem CID | 57291620 |
| Molecular Formula | C24H32N2O |
| Molecular Weight | 364.53 g/mol |
| Exact Mass | 364.25 |
| IUPAC Name | N,N-dimethyl-4-(2-methylpiperidin-1-yl)-2,2-diphenylbutanamide |
| SMILES | CC1CCCCN1CCC(C(=O)N(C)C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H32N2O/c1-20-12-10-11-18-26(20)19-17-24(23(27)25(2)3,21-13-6-4-7-14-21)22-15-8-5-9-16-22/h4-9,13-16,20H,10-12,17-19H2,1-3H3 |
| InChIKey | IYFWUZFFZXFFSX-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.53 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |