C31H40N2O — CID 142899302
N,N-dimethyl-2,2-diphenyl-4-(4-phenylpiperidin-1-yl)butanamide;ethane (PubChem CID 142899302) has the molecular formula C31H40N2O and a molecular weight of 456.67 g/mol. Its IUPAC name is N,N-dimethyl-2,2-diphenyl-4-(4-phenylpiperidin-1-yl)butanamide;ethane.
| Compound Name | N,N-dimethyl-2,2-diphenyl-4-(4-phenylpiperidin-1-yl)butanamide;ethane |
|---|---|
| PubChem CID | 142899302 |
| Molecular Formula | C31H40N2O |
| Molecular Weight | 456.67 g/mol |
| Exact Mass | 456.31 |
| IUPAC Name | N,N-dimethyl-2,2-diphenyl-4-(4-phenylpiperidin-1-yl)butanamide;ethane |
| SMILES | CC.CN(C)C(=O)C(CCN1CCC(c2ccccc2)CC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H34N2O.C2H6/c1-30(2)28(32)29(26-14-8-4-9-15-26,27-16-10-5-11-17-27)20-23-31-21-18-25(19-22-31)24-12-6-3-7-13-24;1-2/h3-17,25H,18-23H2,1-2H3;1-2H3 |
| InChIKey | VCOBNQAKJTVPOO-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.67 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |