C36H44N4O4 — CID 10461152
5-[8-[4-(dimethylamino)-4-oxo-3,3-diphenylbutyl]-4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-3-yl]pentanoic acid (PubChem CID 10461152) has the molecular formula C36H44N4O4 and a molecular weight of 596.77 g/mol. Its IUPAC name is 5-[8-[4-(dimethylamino)-4-oxo-3,3-diphenylbutyl]-4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-3-yl]pentanoic acid.
| Compound Name | 5-[8-[4-(dimethylamino)-4-oxo-3,3-diphenylbutyl]-4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-3-yl]pentanoic acid |
|---|---|
| PubChem CID | 10461152 |
| Molecular Formula | C36H44N4O4 |
| Molecular Weight | 596.77 g/mol |
| Exact Mass | 596.34 |
| IUPAC Name | 5-[8-[4-(dimethylamino)-4-oxo-3,3-diphenylbutyl]-4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-3-yl]pentanoic acid |
| SMILES | CN(C)C(=O)C(CCN1CCC2(CC1)C(=O)N(CCCCC(=O)O)CN2c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C36H44N4O4/c1-37(2)34(44)36(29-14-6-3-7-15-29,30-16-8-4-9-17-30)23-27-38-25-21-35(22-26-38)33(43)39(24-13-12-20-32(41)42)28-40(35)31-18-10-5-11-19-31/h3-11,14-19H,12-13,20-28H2,1-2H3,(H,41,42) |
| InChIKey | MHOMDBVBMCHNIG-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 84.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.77 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|