C28H41N5O4 — CID 3619702
3-[2-(4-acetylpiperazin-1-yl)-2-oxoethyl]-8-heptanoyl-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one (PubChem CID 3619702) has the molecular formula C28H41N5O4 and a molecular weight of 511.67 g/mol. Its IUPAC name is 3-[2-(4-acetylpiperazin-1-yl)-2-oxoethyl]-8-heptanoyl-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one.
| Compound Name | 3-[2-(4-acetylpiperazin-1-yl)-2-oxoethyl]-8-heptanoyl-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one |
|---|---|
| PubChem CID | 3619702 |
| Molecular Formula | C28H41N5O4 |
| Molecular Weight | 511.67 g/mol |
| Exact Mass | 511.32 |
| IUPAC Name | 3-[2-(4-acetylpiperazin-1-yl)-2-oxoethyl]-8-heptanoyl-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one |
| SMILES | CCCCCCC(=O)N1CCC2(CC1)C(=O)N(CC(=O)N1CCN(C(C)=O)CC1)CN2c1ccccc1 |
| InChI | InChI=1S/C28H41N5O4/c1-3-4-5-9-12-25(35)30-15-13-28(14-16-30)27(37)32(22-33(28)24-10-7-6-8-11-24)21-26(36)31-19-17-29(18-20-31)23(2)34/h6-8,10-11H,3-5,9,12-22H2,1-2H3 |
| InChIKey | LRANNXJVXVPZKU-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 84.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.67 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|