C29H44N4O3 — CID 4115667
3-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]-8-octanoyl-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one (PubChem CID 4115667) has the molecular formula C29H44N4O3 and a molecular weight of 496.70 g/mol. Its IUPAC name is 3-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]-8-octanoyl-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one.
| Compound Name | 3-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]-8-octanoyl-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one |
|---|---|
| PubChem CID | 4115667 |
| Molecular Formula | C29H44N4O3 |
| Molecular Weight | 496.70 g/mol |
| Exact Mass | 496.34 |
| IUPAC Name | 3-[2-(4-methylpiperidin-1-yl)-2-oxoethyl]-8-octanoyl-1-phenyl-1,3,8-triazaspiro[4.5]decan-4-one |
| SMILES | CCCCCCCC(=O)N1CCC2(CC1)C(=O)N(CC(=O)N1CCC(C)CC1)CN2c1ccccc1 |
| InChI | InChI=1S/C29H44N4O3/c1-3-4-5-6-10-13-26(34)31-20-16-29(17-21-31)28(36)32(23-33(29)25-11-8-7-9-12-25)22-27(35)30-18-14-24(2)15-19-30/h7-9,11-12,24H,3-6,10,13-23H2,1-2H3 |
| InChIKey | AEZICEDUZYBOJE-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 64.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.70 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|