C27H42N4O3 — CID 5220880
2-(8-heptanoyl-4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-3-yl)-N-(2-methylbutyl)acetamide (PubChem CID 5220880) has the molecular formula C27H42N4O3 and a molecular weight of 470.66 g/mol. Its IUPAC name is 2-(8-heptanoyl-4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-3-yl)-N-(2-methylbutyl)acetamide.
| Compound Name | 2-(8-heptanoyl-4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-3-yl)-N-(2-methylbutyl)acetamide |
|---|---|
| PubChem CID | 5220880 |
| Molecular Formula | C27H42N4O3 |
| Molecular Weight | 470.66 g/mol |
| Exact Mass | 470.33 |
| IUPAC Name | 2-(8-heptanoyl-4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-3-yl)-N-(2-methylbutyl)acetamide |
| SMILES | CCCCCCC(=O)N1CCC2(CC1)C(=O)N(CC(=O)NCC(C)CC)CN2c1ccccc1 |
| InChI | InChI=1S/C27H42N4O3/c1-4-6-7-11-14-25(33)29-17-15-27(16-18-29)26(34)30(20-24(32)28-19-22(3)5-2)21-31(27)23-12-9-8-10-13-23/h8-10,12-13,22H,4-7,11,14-21H2,1-3H3,(H,28,32) |
| InChIKey | URXJBQVKICYXPH-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.66 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|