C28H44N4O3 — CID 3638117
N-(2-methylbutyl)-2-(8-octanoyl-4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-3-yl)acetamide (PubChem CID 3638117) has the molecular formula C28H44N4O3 and a molecular weight of 484.69 g/mol. Its IUPAC name is N-(2-methylbutyl)-2-(8-octanoyl-4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-3-yl)acetamide.
| Compound Name | N-(2-methylbutyl)-2-(8-octanoyl-4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-3-yl)acetamide |
|---|---|
| PubChem CID | 3638117 |
| Molecular Formula | C28H44N4O3 |
| Molecular Weight | 484.69 g/mol |
| Exact Mass | 484.34 |
| IUPAC Name | N-(2-methylbutyl)-2-(8-octanoyl-4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-3-yl)acetamide |
| SMILES | CCCCCCCC(=O)N1CCC2(CC1)C(=O)N(CC(=O)NCC(C)CC)CN2c1ccccc1 |
| InChI | InChI=1S/C28H44N4O3/c1-4-6-7-8-12-15-26(34)30-18-16-28(17-19-30)27(35)31(21-25(33)29-20-23(3)5-2)22-32(28)24-13-10-9-11-14-24/h9-11,13-14,23H,4-8,12,15-22H2,1-3H3,(H,29,33) |
| InChIKey | XQCDIONJKHXFIP-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.69 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|