C31H40N4O4 — CID 163461583
6-[4-oxo-8-[4-(2-oxo-3H-benzimidazol-1-yl)butyl]-1-phenyl-1,3-diazaspiro[4.5]decan-3-yl]hexanoic acid (PubChem CID 163461583) has the molecular formula C31H40N4O4 and a molecular weight of 532.69 g/mol. Its IUPAC name is 6-[4-oxo-8-[4-(2-oxo-3H-benzimidazol-1-yl)butyl]-1-phenyl-1,3-diazaspiro[4.5]decan-3-yl]hexanoic acid.
| Compound Name | 6-[4-oxo-8-[4-(2-oxo-3H-benzimidazol-1-yl)butyl]-1-phenyl-1,3-diazaspiro[4.5]decan-3-yl]hexanoic acid |
|---|---|
| PubChem CID | 163461583 |
| Molecular Formula | C31H40N4O4 |
| Molecular Weight | 532.69 g/mol |
| Exact Mass | 532.30 |
| IUPAC Name | 6-[4-oxo-8-[4-(2-oxo-3H-benzimidazol-1-yl)butyl]-1-phenyl-1,3-diazaspiro[4.5]decan-3-yl]hexanoic acid |
| SMILES | O=C(O)CCCCCN1CN(c2ccccc2)C2(CCC(CCCCn3c(=O)[nH]c4ccccc43)CC2)C1=O |
| InChI | InChI=1S/C31H40N4O4/c36-28(37)16-5-2-9-21-33-23-35(25-12-3-1-4-13-25)31(29(33)38)19-17-24(18-20-31)11-8-10-22-34-27-15-7-6-14-26(27)32-30(34)39/h1,3-4,6-7,12-15,24H,2,5,8-11,16-23H2,(H,32,39)(H,36,37) |
| InChIKey | BPAPBZBXXIBULN-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 98.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.69 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|