C15H20N2NaO3 — CID 70523740
CID 70523740 (PubChem CID 70523740) has the molecular formula C15H20N2NaO3 and a molecular weight of 299.33 g/mol.
| Compound Name | CID 70523740 |
|---|---|
| PubChem CID | 70523740 |
| Molecular Formula | C15H20N2NaO3 |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | — |
| SMILES | O=C(O)CCCCCCCn1c(=O)[nH]c2ccccc21.[Na] |
| InChI | InChI=1S/C15H20N2O3.Na/c18-14(19)10-4-2-1-3-7-11-17-13-9-6-5-8-12(13)16-15(17)20;/h5-6,8-9H,1-4,7,10-11H2,(H,16,20)(H,18,19); |
| InChIKey | YIMSULJGILYCMG-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 75.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|