C30H35IN2O2 — CID 89357629
4-[4-hydroxy-4-[4-(iodomethyl)phenyl]piperidin-1-yl]-N,N-dimethyl-2,2-diphenylbutanamide (PubChem CID 89357629) has the molecular formula C30H35IN2O2 and a molecular weight of 582.53 g/mol. Its IUPAC name is 4-[4-hydroxy-4-[4-(iodomethyl)phenyl]piperidin-1-yl]-N,N-dimethyl-2,2-diphenylbutanamide.
| Compound Name | 4-[4-hydroxy-4-[4-(iodomethyl)phenyl]piperidin-1-yl]-N,N-dimethyl-2,2-diphenylbutanamide |
|---|---|
| PubChem CID | 89357629 |
| Molecular Formula | C30H35IN2O2 |
| Molecular Weight | 582.53 g/mol |
| Exact Mass | 582.17 |
| IUPAC Name | 4-[4-hydroxy-4-[4-(iodomethyl)phenyl]piperidin-1-yl]-N,N-dimethyl-2,2-diphenylbutanamide |
| SMILES | CN(C)C(=O)C(CCN1CCC(O)(c2ccc(CI)cc2)CC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H35IN2O2/c1-32(2)28(34)30(26-9-5-3-6-10-26,27-11-7-4-8-12-27)19-22-33-20-17-29(35,18-21-33)25-15-13-24(23-31)14-16-25/h3-16,35H,17-23H2,1-2H3 |
| InChIKey | RTUFFRPTANPZBW-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.53 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|