C31H40ClN3O5S — CID 87775867
2-aminoethanesulfonic acid;4-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-N,N-dimethyl-2,2-diphenylbutanamide (PubChem CID 87775867) has the molecular formula C31H40ClN3O5S and a molecular weight of 602.20 g/mol. Its IUPAC name is 2-aminoethanesulfonic acid;4-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-N,N-dimethyl-2,2-diphenylbutanamide.
| Compound Name | 2-aminoethanesulfonic acid;4-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-N,N-dimethyl-2,2-diphenylbutanamide |
|---|---|
| PubChem CID | 87775867 |
| Molecular Formula | C31H40ClN3O5S |
| Molecular Weight | 602.20 g/mol |
| Exact Mass | 601.24 |
| IUPAC Name | 2-aminoethanesulfonic acid;4-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-N,N-dimethyl-2,2-diphenylbutanamide |
| SMILES | CN(C)C(=O)C(CCN1CCC(O)(c2ccc(Cl)cc2)CC1)(c1ccccc1)c1ccccc1.NCCS(=O)(=O)O |
| InChI | InChI=1S/C29H33ClN2O2.C2H7NO3S/c1-31(2)27(33)29(24-9-5-3-6-10-24,25-11-7-4-8-12-25)19-22-32-20-17-28(34,18-21-32)23-13-15-26(30)16-14-23;3-1-2-7(4,5)6/h3-16,34H,17-22H2,1-2H3;1-3H2,(H,4,5,6) |
| InChIKey | LJYQQDPZOGQQQM-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 124.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.20 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|