C33H42ClN3O3 — CID 10995329
1-[5-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-2,2-diphenylpentyl]-3-(4-hydroxybutyl)urea (PubChem CID 10995329) has the molecular formula C33H42ClN3O3 and a molecular weight of 564.17 g/mol. Its IUPAC name is 1-[5-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-2,2-diphenylpentyl]-3-(4-hydroxybutyl)urea.
| Compound Name | 1-[5-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-2,2-diphenylpentyl]-3-(4-hydroxybutyl)urea |
|---|---|
| PubChem CID | 10995329 |
| Molecular Formula | C33H42ClN3O3 |
| Molecular Weight | 564.17 g/mol |
| Exact Mass | 563.29 |
| IUPAC Name | 1-[5-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-2,2-diphenylpentyl]-3-(4-hydroxybutyl)urea |
| SMILES | O=C(NCCCCO)NCC(CCCN1CCC(O)(c2ccc(Cl)cc2)CC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H42ClN3O3/c34-30-16-14-29(15-17-30)33(40)19-23-37(24-20-33)22-9-18-32(27-10-3-1-4-11-27,28-12-5-2-6-13-28)26-36-31(39)35-21-7-8-25-38/h1-6,10-17,38,40H,7-9,18-26H2,(H2,35,36,39) |
| InChIKey | XKODNICTPMTYQO-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.17 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|