C39H49ClN4O5 — CID 54020921
ethyl 3-[4-[[5-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-2,2-diphenylpentyl]carbamoylamino]piperidin-1-yl]-3-oxopropanoate (PubChem CID 54020921) has the molecular formula C39H49ClN4O5 and a molecular weight of 689.30 g/mol. Its IUPAC name is ethyl 3-[4-[[5-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-2,2-diphenylpentyl]carbamoylamino]piperidin-1-yl]-3-oxopropanoate.
| Compound Name | ethyl 3-[4-[[5-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-2,2-diphenylpentyl]carbamoylamino]piperidin-1-yl]-3-oxopropanoate |
|---|---|
| PubChem CID | 54020921 |
| Molecular Formula | C39H49ClN4O5 |
| Molecular Weight | 689.30 g/mol |
| Exact Mass | 688.34 |
| IUPAC Name | ethyl 3-[4-[[5-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-2,2-diphenylpentyl]carbamoylamino]piperidin-1-yl]-3-oxopropanoate |
| SMILES | CCOC(=O)CC(=O)N1CCC(NC(=O)NCC(CCCN2CCC(O)(c3ccc(Cl)cc3)CC2)(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C39H49ClN4O5/c1-2-49-36(46)28-35(45)44-24-18-34(19-25-44)42-37(47)41-29-38(30-10-5-3-6-11-30,31-12-7-4-8-13-31)20-9-23-43-26-21-39(48,22-27-43)32-14-16-33(40)17-15-32/h3-8,10-17,34,48H,2,9,18-29H2,1H3,(H2,41,42,47) |
| InChIKey | KYWANYSJVIIUAG-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 111.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.30 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|