C33H40ClN3O4 — CID 70100690
4-[[5-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-2,2-diphenylpentyl]carbamoylamino]butanoic acid (PubChem CID 70100690) has the molecular formula C33H40ClN3O4 and a molecular weight of 578.15 g/mol. Its IUPAC name is 4-[[5-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-2,2-diphenylpentyl]carbamoylamino]butanoic acid.
| Compound Name | 4-[[5-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-2,2-diphenylpentyl]carbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 70100690 |
| Molecular Formula | C33H40ClN3O4 |
| Molecular Weight | 578.15 g/mol |
| Exact Mass | 577.27 |
| IUPAC Name | 4-[[5-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-2,2-diphenylpentyl]carbamoylamino]butanoic acid |
| SMILES | O=C(O)CCCNC(=O)NCC(CCCN1CCC(O)(c2ccc(Cl)cc2)CC1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H40ClN3O4/c34-29-16-14-28(15-17-29)33(41)19-23-37(24-20-33)22-8-18-32(26-9-3-1-4-10-26,27-11-5-2-6-12-27)25-36-31(40)35-21-7-13-30(38)39/h1-6,9-12,14-17,41H,7-8,13,18-25H2,(H,38,39)(H2,35,36,40) |
| InChIKey | SNWKGWOCCPATRZ-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.15 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|