C31H41Cl3N4O3 — CID 70101282
1-[5-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-2-phenyl-2-pyridin-2-ylpentyl]-3-(3-hydroxypropyl)urea;dihydrochloride (PubChem CID 70101282) has the molecular formula C31H41Cl3N4O3 and a molecular weight of 624.05 g/mol. Its IUPAC name is 1-[5-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-2-phenyl-2-pyridin-2-ylpentyl]-3-(3-hydroxypropyl)urea;dihydrochloride.
| Compound Name | 1-[5-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-2-phenyl-2-pyridin-2-ylpentyl]-3-(3-hydroxypropyl)urea;dihydrochloride |
|---|---|
| PubChem CID | 70101282 |
| Molecular Formula | C31H41Cl3N4O3 |
| Molecular Weight | 624.05 g/mol |
| Exact Mass | 622.22 |
| IUPAC Name | 1-[5-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-2-phenyl-2-pyridin-2-ylpentyl]-3-(3-hydroxypropyl)urea;dihydrochloride |
| SMILES | Cl.Cl.O=C(NCCCO)NCC(CCCN1CCC(O)(c2ccc(Cl)cc2)CC1)(c1ccccc1)c1ccccn1 |
| InChI | InChI=1S/C31H39ClN4O3.2ClH/c32-27-13-11-26(12-14-27)31(39)16-21-36(22-17-31)20-6-15-30(25-8-2-1-3-9-25,28-10-4-5-18-33-28)24-35-29(38)34-19-7-23-37;;/h1-5,8-14,18,37,39H,6-7,15-17,19-24H2,(H2,34,35,38);2*1H |
| InChIKey | OIKPQKGVVKFGDR-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 97.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.05 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|