C32H38ClF2N3O3 — CID 70102195
1-[5-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-2,2-bis(4-fluorophenyl)pentyl]-3-(3-hydroxypropyl)urea (PubChem CID 70102195) has the molecular formula C32H38ClF2N3O3 and a molecular weight of 586.12 g/mol. Its IUPAC name is 1-[5-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-2,2-bis(4-fluorophenyl)pentyl]-3-(3-hydroxypropyl)urea.
| Compound Name | 1-[5-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-2,2-bis(4-fluorophenyl)pentyl]-3-(3-hydroxypropyl)urea |
|---|---|
| PubChem CID | 70102195 |
| Molecular Formula | C32H38ClF2N3O3 |
| Molecular Weight | 586.12 g/mol |
| Exact Mass | 585.26 |
| IUPAC Name | 1-[5-[4-(4-chlorophenyl)-4-hydroxypiperidin-1-yl]-2,2-bis(4-fluorophenyl)pentyl]-3-(3-hydroxypropyl)urea |
| SMILES | O=C(NCCCO)NCC(CCCN1CCC(O)(c2ccc(Cl)cc2)CC1)(c1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C32H38ClF2N3O3/c33-27-9-3-26(4-10-27)32(41)16-20-38(21-17-32)19-1-15-31(24-5-11-28(34)12-6-24,25-7-13-29(35)14-8-25)23-37-30(40)36-18-2-22-39/h3-14,39,41H,1-2,15-23H2,(H2,36,37,40) |
| InChIKey | SJBKVVIDJXJIIC-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 84.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.12 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|