C23H29ClFNOS — CID 67743242
4-(4-chlorophenyl)-1-[4-(4-fluorophenyl)-4-methylsulfanylpentyl]piperidin-4-ol (PubChem CID 67743242) has the molecular formula C23H29ClFNOS and a molecular weight of 422.01 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-1-[4-(4-fluorophenyl)-4-methylsulfanylpentyl]piperidin-4-ol.
| Compound Name | 4-(4-chlorophenyl)-1-[4-(4-fluorophenyl)-4-methylsulfanylpentyl]piperidin-4-ol |
|---|---|
| PubChem CID | 67743242 |
| Molecular Formula | C23H29ClFNOS |
| Molecular Weight | 422.01 g/mol |
| Exact Mass | 421.16 |
| IUPAC Name | 4-(4-chlorophenyl)-1-[4-(4-fluorophenyl)-4-methylsulfanylpentyl]piperidin-4-ol |
| SMILES | CSC(C)(CCCN1CCC(O)(c2ccc(Cl)cc2)CC1)c1ccc(F)cc1 |
| InChI | InChI=1S/C23H29ClFNOS/c1-22(28-2,18-6-10-21(25)11-7-18)12-3-15-26-16-13-23(27,14-17-26)19-4-8-20(24)9-5-19/h4-11,27H,3,12-17H2,1-2H3 |
| InChIKey | MFLMVGSXZXZWCI-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.01 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |